Products 2349645-02-7
CAS 2349645-02-7 is the registry number for (R)-2-((tert-Butoxycarbonyl)amino)-4-(dimethylamino)butanoic acid, 97%. Offered by: Fluorochem. Available pack sizes: 100mg.
(2R)-4-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 2349645-02-7) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: (2R)-4-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: YEKMUOMXRLSQDM-MRVPVSSYSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (2R)-4-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | YEKMUOMXRLSQDM-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCN(C)C)C(=O)O |
Computed by PubChem (NCBI)