CAS 1816285-08-1 is the registry number for 5-(Pentafluoroethyl)nicotinaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-(1,1,2,2,2-pentafluoroethyl)pyridine-3-carbaldehyde (CAS 1816285-08-1) is a chemical compound with the molecular formula C8H4F5NO and a molecular weight of 225.11 g/mol. IUPAC name: 5-(1,1,2,2,2-pentafluoroethyl)pyridine-3-carbaldehyde. InChIKey: PDWBPCGEGQDMQF-UHFFFAOYSA-N.
| Molecular formula | C8H4F5NO |
|---|---|
| Molecular weight | 225.11 g/mol |
| IUPAC name | 5-(1,1,2,2,2-pentafluoroethyl)pyridine-3-carbaldehyde |
| InChIKey | PDWBPCGEGQDMQF-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1C(C(F)(F)F)(F)F)C=O |
Computed by PubChem (NCBI)