CAS 98651-71-9 is the registry number for N-(2,4-Difluorophenyl)-2,2,2-trifluoroacetamide. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 250mg, 2,5g.
N-(2,4-difluorophenyl)-2,2,2-trifluoroacetamide (CAS 98651-71-9) is a chemical compound with the molecular formula C8H4F5NO and a molecular weight of 225.11 g/mol. IUPAC name: N-(2,4-difluorophenyl)-2,2,2-trifluoroacetamide. InChIKey: KFBSEUVNGYXFLB-UHFFFAOYSA-N.
| Molecular formula | C8H4F5NO |
|---|---|
| Molecular weight | 225.11 g/mol |
| IUPAC name | N-(2,4-difluorophenyl)-2,2,2-trifluoroacetamide |
| InChIKey | KFBSEUVNGYXFLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)