CAS 98634-00-5 is the registry number for N-(2,6-Difluorophenyl)-2,2,2-trifluoroacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,6-difluorophenyl)-2,2,2-trifluoroacetamide (CAS 98634-00-5) is a chemical compound with the molecular formula C8H4F5NO and a molecular weight of 225.11 g/mol. IUPAC name: N-(2,6-difluorophenyl)-2,2,2-trifluoroacetamide. InChIKey: JZCNHJAYRJZQGO-UHFFFAOYSA-N.
| Molecular formula | C8H4F5NO |
|---|---|
| Molecular weight | 225.11 g/mol |
| IUPAC name | N-(2,6-difluorophenyl)-2,2,2-trifluoroacetamide |
| InChIKey | JZCNHJAYRJZQGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)NC(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)