Products 186517-26-0

CAS 186517-26-0 is the registry number for 2,3-Difluoro-6-trifluoromethylbenzamide. Offered by: TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 100mg, 25mg, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,3-difluoro-6-(trifluoromethyl)benzamide (CAS 186517-26-0) is a chemical compound with the molecular formula C8H4F5NO and a molecular weight of 225.11 g/mol. IUPAC name: 2,3-difluoro-6-(trifluoromethyl)benzamide. InChIKey: GGCPJJFCTISPMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4F5NO
Molecular weight225.11 g/mol
IUPAC name2,3-difluoro-6-(trifluoromethyl)benzamide
InChIKeyGGCPJJFCTISPMQ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(F)(F)F)C(=O)N)F)F

Computed by PubChem (NCBI)