Products 1817006-92-0
CAS 1817006-92-0 appears in our catalog under these names: Diethyl phthalate–d10, Diethyl phthalate-D10, 98%, 98 atom%D, ≥96%,≥98 atom% D, ≥96%,≥98 atom% D, Diethyl phthalate-d10. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 1 mg.
Bis(1,1,2,2,2-pentadeuterioethyl) benzene-1,2-dicarboxylate (CAS 1817006-92-0) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 232.30 g/mol. IUPAC name: bis(1,1,2,2,2-pentadeuterioethyl) benzene-1,2-dicarboxylate. InChIKey: FLKPEMZONWLCSK-MWUKXHIBSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 232.30 g/mol |
| IUPAC name | bis(1,1,2,2,2-pentadeuterioethyl) benzene-1,2-dicarboxylate |
| InChIKey | FLKPEMZONWLCSK-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)C1=CC=CC=C1C(=O)OC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)