Products 181866-83-1

CAS 181866-83-1 is the registry number for 3-(Ethoxycarbonyl)-4-methyl-2-furanpropanoic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(3-ethoxy-3-oxopropyl)-4-methylfuran-3-carboxylate (CAS 181866-83-1) is a chemical compound with the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. IUPAC name: ethyl 2-(3-ethoxy-3-oxopropyl)-4-methylfuran-3-carboxylate. InChIKey: VMRAVXPCPVDTPW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O5
Molecular weight254.28 g/mol
IUPAC nameethyl 2-(3-ethoxy-3-oxopropyl)-4-methylfuran-3-carboxylate
InChIKeyVMRAVXPCPVDTPW-UHFFFAOYSA-N
SMILESCCOC(=O)CCC1=C(C(=CO1)C)C(=O)OCC

Computed by PubChem (NCBI)