CAS 1818847-61-8 appears in our catalog under these names: 4-(Aminomethyl)-1h,2h,3h-pyrrolo[2,3-b]pyridin-2-one dihydrochloride, 95%, 4-(Aminomethyl)-1H-pyrrolo(2,3-b)pyridin-2(3H)-one dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-(aminomethyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one;dihydrochloride (CAS 1818847-61-8) is a chemical compound with the molecular formula C8H11Cl2N3O and a molecular weight of 236.10 g/mol. IUPAC name: 4-(aminomethyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one;dihydrochloride. InChIKey: GECPSTYRWJWWHA-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3O |
|---|---|
| Molecular weight | 236.10 g/mol |
| IUPAC name | 4-(aminomethyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one;dihydrochloride |
| InChIKey | GECPSTYRWJWWHA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CN=C2NC1=O)CN.Cl.Cl |
Computed by PubChem (NCBI)