CAS 860503-30-6 appears in our catalog under these names: 7-Amino-3,4-dihydro-1h-quinoxalin-2-one dihydrochloride, 97%, 7-Amino-3,4-dihydroquinoxalin-2(1H)-one dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
7-amino-3,4-dihydro-1H-quinoxalin-2-one;dihydrochloride (CAS 860503-30-6) is a chemical compound with the molecular formula C8H11Cl2N3O and a molecular weight of 236.10 g/mol. IUPAC name: 7-amino-3,4-dihydro-1H-quinoxalin-2-one;dihydrochloride. InChIKey: UNOXORFTTKAYLY-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3O |
|---|---|
| Molecular weight | 236.10 g/mol |
| IUPAC name | 7-amino-3,4-dihydro-1H-quinoxalin-2-one;dihydrochloride |
| InChIKey | UNOXORFTTKAYLY-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(N1)C=CC(=C2)N.Cl.Cl |
Computed by PubChem (NCBI)