CAS 1860893-14-6 appears in our catalog under these names: 6-(Aminomethyl)-1,2-benzoxazol-3-amine dihydrochloride, 6-(Aminomethyl)-1,2-benzoxazol-3-amine dihydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
6-(aminomethyl)-1,2-benzoxazol-3-amine;dihydrochloride (CAS 1860893-14-6) is a chemical compound with the molecular formula C8H11Cl2N3O and a molecular weight of 236.10 g/mol. IUPAC name: 6-(aminomethyl)-1,2-benzoxazol-3-amine;dihydrochloride. InChIKey: ABICOYFWPUKFHU-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3O |
|---|---|
| Molecular weight | 236.10 g/mol |
| IUPAC name | 6-(aminomethyl)-1,2-benzoxazol-3-amine;dihydrochloride |
| InChIKey | ABICOYFWPUKFHU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CN)ON=C2N.Cl.Cl |
Computed by PubChem (NCBI)