CAS 847684-79-1 is the registry number for 3-Amino-1,2,3,4-tetrahydro-1,6-naphthyridin-2-one dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-amino-3,4-dihydro-1H-1,6-naphthyridin-2-one;dihydrochloride (CAS 847684-79-1) is a chemical compound with the molecular formula C8H11Cl2N3O and a molecular weight of 236.10 g/mol. IUPAC name: 3-amino-3,4-dihydro-1H-1,6-naphthyridin-2-one;dihydrochloride. InChIKey: VNEKYGVKUURXQR-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3O |
|---|---|
| Molecular weight | 236.10 g/mol |
| IUPAC name | 3-amino-3,4-dihydro-1H-1,6-naphthyridin-2-one;dihydrochloride |
| InChIKey | VNEKYGVKUURXQR-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC2=C1C=NC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)