Products 18199-64-9
CAS 18199-64-9 appears in our catalog under these names: Angenomalin, Angenomalin, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 5mg, 25mg, 10mg.
8-prop-1-en-2-yl-8,9-dihydrofuro[2,3-h]chromen-2-one (CAS 18199-64-9) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 8-prop-1-en-2-yl-8,9-dihydrofuro[2,3-h]chromen-2-one. InChIKey: WLRXMMDATRQQNQ-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 8-prop-1-en-2-yl-8,9-dihydrofuro[2,3-h]chromen-2-one |
| InChIKey | WLRXMMDATRQQNQ-UHFFFAOYSA-N |
| SMILES | CC(=C)C1CC2=C(O1)C=CC3=C2OC(=O)C=C3 |
Computed by PubChem (NCBI)