Products 18201-65-5
CAS 18201-65-5 appears in our catalog under these names: Dichlorophenyl–ABA, Dichlorophenyl-ABA, 99.79%, Dichlorophenyl-ABA, 98%, 2-((3,5-Dichlorophenyl)amino)benzoic acid, 98%. Offered by: GLPBio, MedChemExpress, Ambeed, BLDpharm, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25 mg, 50 mg, 10 mg, 5 mg, 10mM/1mL.
2-(3,5-dichloroanilino)benzoic acid (CAS 18201-65-5) is a chemical compound with the molecular formula C13H9Cl2NO2 and a molecular weight of 282.12 g/mol. IUPAC name: 2-(3,5-dichloroanilino)benzoic acid. InChIKey: FNGSQOJHNAYHAT-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO2 |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | 2-(3,5-dichloroanilino)benzoic acid |
| InChIKey | FNGSQOJHNAYHAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-[(3,5-dichlorophenyl)amino]benzoic acid, 2-((3,5-Dichlorophenyl)amino)benzoic acid, Dichlorophenyl-ABA, Dichlorophenyl ABA, 2-(3,5-dichloroanilino)benzoic acid, benzoic acid, 2-[(3,5-dichlorophenyl)amino]-, 2-(3,5-dichlorophenylamino)benzoic acid, benzoic acid,2-[(3,5-dichlorophenyl)amino]-, orb1707379, Dichlorophenyl-ABA, >=98% (HPLC), solid