Products 1820569-46-7
CAS 1820569-46-7 appears in our catalog under these names: (1S，2S)-2-(Difluoromethyl)Cyclopropanecarboxylic Acid, 95%, 95%, (1S,2S)-2-(Difluoromethyl)cyclopropanecarboxylic acid, 95%, (1S,2S)-2-(Difluoromethyl)cyclopropane-1-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Trans-(1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylic acid (CAS 1820569-46-7) is a chemical compound with the molecular formula C5H6F2O2 and a molecular weight of 136.10 g/mol. IUPAC name: trans-(1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: AQPYFAYLGMEWCD-HRFVKAFMSA-N.
| Molecular formula | C5H6F2O2 |
|---|---|
| Molecular weight | 136.10 g/mol |
| IUPAC name | trans-(1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | AQPYFAYLGMEWCD-HRFVKAFMSA-N |
| SMILES | C1[C@@H]([C@H]1C(=O)O)C(F)F |
Computed by PubChem (NCBI)