CAS 2306247-44-7 appears in our catalog under these names: (1S,2R)-2-(Difluoromethyl)cyclopropane-1-carboxylic acid, 98%, (1S,2R)-2-(difluoromethyl)cyclopropanecarboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
Cis-(1S,2R)-2-(difluoromethyl)cyclopropane-1-carboxylic acid (CAS 2306247-44-7) is a chemical compound with the molecular formula C5H6F2O2 and a molecular weight of 136.10 g/mol. IUPAC name: cis-(1S,2R)-2-(difluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: AQPYFAYLGMEWCD-GBXIJSLDSA-N.
| Molecular formula | C5H6F2O2 |
|---|---|
| Molecular weight | 136.10 g/mol |
| IUPAC name | cis-(1S,2R)-2-(difluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | AQPYFAYLGMEWCD-GBXIJSLDSA-N |
| SMILES | C1[C@H]([C@H]1C(=O)O)C(F)F |
Computed by PubChem (NCBI)