Products 1820571-66-1
CAS 1820571-66-1 is the registry number for Rac-(1r,2s,3r,4s)-3-amino-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid;hydrochloride (CAS 1820571-66-1) is a chemical compound with the molecular formula C7H10ClNO3 and a molecular weight of 191.61 g/mol. IUPAC name: (1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid;hydrochloride. InChIKey: PLIWFZMNPKLWTL-HRDKBJBWSA-N.
| Molecular formula | C7H10ClNO3 |
|---|---|
| Molecular weight | 191.61 g/mol |
| IUPAC name | (1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid;hydrochloride |
| InChIKey | PLIWFZMNPKLWTL-HRDKBJBWSA-N |
| SMILES | C1=C[C@H]2[C@@H]([C@@H]([C@@H]1O2)C(=O)O)N.Cl |
Computed by PubChem (NCBI)