Products 23500-18-7

CAS 23500-18-7 is the registry number for Anagliptin Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-(2-chloroacetyl)pyrrolidine-2-carboxylic acid (CAS 23500-18-7) is a chemical compound with the molecular formula C7H10ClNO3 and a molecular weight of 191.61 g/mol. IUPAC name: 1-(2-chloroacetyl)pyrrolidine-2-carboxylic acid. InChIKey: LXDUOIDIFSKLNB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10ClNO3
Molecular weight191.61 g/mol
IUPAC name1-(2-chloroacetyl)pyrrolidine-2-carboxylic acid
InChIKeyLXDUOIDIFSKLNB-UHFFFAOYSA-N
SMILESC1CC(N(C1)C(=O)CCl)C(=O)O

Computed by PubChem (NCBI)