Products 23500-11-0

CAS 23500-11-0 is the registry number for Vildagliptin Impurity 109. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R)-1-(2-chloroacetyl)pyrrolidine-2-carboxylic acid (CAS 23500-11-0) is a chemical compound with the molecular formula C7H10ClNO3 and a molecular weight of 191.61 g/mol. IUPAC name: (2R)-1-(2-chloroacetyl)pyrrolidine-2-carboxylic acid. InChIKey: LXDUOIDIFSKLNB-RXMQYKEDSA-N.

Identity
Molecular formulaC7H10ClNO3
Molecular weight191.61 g/mol
IUPAC name(2R)-1-(2-chloroacetyl)pyrrolidine-2-carboxylic acid
InChIKeyLXDUOIDIFSKLNB-RXMQYKEDSA-N
SMILESC1C[C@@H](N(C1)C(=O)CCl)C(=O)O

Computed by PubChem (NCBI)