CAS 23500-11-0 is the registry number for Vildagliptin Impurity 109. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-1-(2-chloroacetyl)pyrrolidine-2-carboxylic acid (CAS 23500-11-0) is a chemical compound with the molecular formula C7H10ClNO3 and a molecular weight of 191.61 g/mol. IUPAC name: (2R)-1-(2-chloroacetyl)pyrrolidine-2-carboxylic acid. InChIKey: LXDUOIDIFSKLNB-RXMQYKEDSA-N.
| Molecular formula | C7H10ClNO3 |
|---|---|
| Molecular weight | 191.61 g/mol |
| IUPAC name | (2R)-1-(2-chloroacetyl)pyrrolidine-2-carboxylic acid |
| InChIKey | LXDUOIDIFSKLNB-RXMQYKEDSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)CCl)C(=O)O |
Computed by PubChem (NCBI)