Products 944467-86-1

CAS 944467-86-1 is the registry number for 4-(Aminomethyl)-5-methyl-2-furoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-(aminomethyl)-5-methylfuran-2-carboxylic acid;hydrochloride (CAS 944467-86-1) is a chemical compound with the molecular formula C7H10ClNO3 and a molecular weight of 191.61 g/mol. IUPAC name: 4-(aminomethyl)-5-methylfuran-2-carboxylic acid;hydrochloride. InChIKey: RNQWQGZLNJIPAH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10ClNO3
Molecular weight191.61 g/mol
IUPAC name4-(aminomethyl)-5-methylfuran-2-carboxylic acid;hydrochloride
InChIKeyRNQWQGZLNJIPAH-UHFFFAOYSA-N
SMILESCC1=C(C=C(O1)C(=O)O)CN.Cl

Computed by PubChem (NCBI)