CAS 2177263-70-4 appears in our catalog under these names: 3-Amino-3-(furan-2-yl)propanoic acid hydrochloride, 95%, 3–Amino–3–(furan–2–yl)propanoic acid hydrochloride, 3-amino-3-(furan-2-yl)propanoic acid hydrochloride, 3-Amino-3-(furan-2-yl)propanoic acid hydrochloride, 97%, 97%, 3-Amino-3-(furan-2-yl)propanoic acid hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 5g, 10g.
3-amino-3-(furan-2-yl)propanoic acid;hydrochloride (CAS 2177263-70-4) is a chemical compound with the molecular formula C7H10ClNO3 and a molecular weight of 191.61 g/mol. IUPAC name: 3-amino-3-(furan-2-yl)propanoic acid;hydrochloride. InChIKey: OWQPNOKUHDOIBK-UHFFFAOYSA-N.
| Molecular formula | C7H10ClNO3 |
|---|---|
| Molecular weight | 191.61 g/mol |
| IUPAC name | 3-amino-3-(furan-2-yl)propanoic acid;hydrochloride |
| InChIKey | OWQPNOKUHDOIBK-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(CC(=O)O)N.Cl |
Computed by PubChem (NCBI)