Products 1820607-78-0
CAS 1820607-78-0 is the registry number for 2-amino-7-methoxy-1,3-benzoxazole-5-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-7-methoxy-1,3-benzoxazole-5-carbaldehyde (CAS 1820607-78-0) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 2-amino-7-methoxy-1,3-benzoxazole-5-carbaldehyde. InChIKey: PASLOZPGEXTBOE-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2-amino-7-methoxy-1,3-benzoxazole-5-carbaldehyde |
| InChIKey | PASLOZPGEXTBOE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1OC(=N2)N)C=O |
Computed by PubChem (NCBI)