CAS 1820615-08-4 is the registry number for 1-(2-amino-1,3-benzoxazol-7-yl)ethanone hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(2-amino-1,3-benzoxazol-7-yl)ethanone;hydrochloride (CAS 1820615-08-4) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: 1-(2-amino-1,3-benzoxazol-7-yl)ethanone;hydrochloride. InChIKey: OADWYWHMGYIZOD-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 1-(2-amino-1,3-benzoxazol-7-yl)ethanone;hydrochloride |
| InChIKey | OADWYWHMGYIZOD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C(=CC=C1)N=C(O2)N.Cl |
Computed by PubChem (NCBI)