Products 1820618-27-6
CAS 1820618-27-6 is the registry number for (1R,5R)-2-(2,4,6-trimethoxybenzyl)-2-azabicyclo[3.1.0]hexan-3-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1R,5R)-2-[(2,4,6-trimethoxyphenyl)methyl]-2-azabicyclo[3.1.0]hexan-3-one (CAS 1820618-27-6) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: (1R,5R)-2-[(2,4,6-trimethoxyphenyl)methyl]-2-azabicyclo[3.1.0]hexan-3-one. InChIKey: LMWIWEUZNJCOTH-BXKDBHETSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (1R,5R)-2-[(2,4,6-trimethoxyphenyl)methyl]-2-azabicyclo[3.1.0]hexan-3-one |
| InChIKey | LMWIWEUZNJCOTH-BXKDBHETSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)CN2[C@@H]3C[C@@H]3CC2=O)OC |
Computed by PubChem (NCBI)