CAS 1820650-69-8 is the registry number for 5-(benzyloxy)-1,3-benzoxazol-2-amine, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-phenylmethoxy-1,3-benzoxazol-2-amine (CAS 1820650-69-8) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 5-phenylmethoxy-1,3-benzoxazol-2-amine. InChIKey: HVDHKOOJSSLNSN-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 5-phenylmethoxy-1,3-benzoxazol-2-amine |
| InChIKey | HVDHKOOJSSLNSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)OC(=N3)N |
Computed by PubChem (NCBI)