Products 1820650-85-8

CAS 1820650-85-8 is the registry number for methyl 2-{3-[4-(methylsulfanyl)phenyl]phenyl}acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-[3-(4-methylsulfanylphenyl)phenyl]acetate (CAS 1820650-85-8) is a chemical compound with the molecular formula C16H16O2S and a molecular weight of 272.4 g/mol. IUPAC name: methyl 2-[3-(4-methylsulfanylphenyl)phenyl]acetate. InChIKey: SXQHEOYPHMRKOK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16O2S
Molecular weight272.4 g/mol
IUPAC namemethyl 2-[3-(4-methylsulfanylphenyl)phenyl]acetate
InChIKeySXQHEOYPHMRKOK-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CC(=CC=C1)C2=CC=C(C=C2)SC

Computed by PubChem (NCBI)