CAS 790263-58-0 appears in our catalog under these names: 3-([(2,4-Dimethylphenyl)sulfanyl]methyl)benzoic acid, 95%, 3-{((2,4-dimethylphenyl)sulfanyl)methyl}benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-[(2,4-dimethylphenyl)sulfanylmethyl]benzoic acid (CAS 790263-58-0) is a chemical compound with the molecular formula C16H16O2S and a molecular weight of 272.4 g/mol. IUPAC name: 3-[(2,4-dimethylphenyl)sulfanylmethyl]benzoic acid. InChIKey: RLTDOPDPXZSEFY-UHFFFAOYSA-N.
| Molecular formula | C16H16O2S |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | 3-[(2,4-dimethylphenyl)sulfanylmethyl]benzoic acid |
| InChIKey | RLTDOPDPXZSEFY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SCC2=CC(=CC=C2)C(=O)O)C |
Computed by PubChem (NCBI)