CAS 18626-51-2 appears in our catalog under these names: 2-((2,4-Dimethylphenyl)sulfanyl)-2-phenylacetic acid, 2-((2,4-Dimethylphenyl)sulfanyl)-2-phenylacetic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
2-(2,4-dimethylphenyl)sulfanyl-2-phenylacetic acid (CAS 18626-51-2) is a chemical compound with the molecular formula C16H16O2S and a molecular weight of 272.4 g/mol. IUPAC name: 2-(2,4-dimethylphenyl)sulfanyl-2-phenylacetic acid. InChIKey: UDDBXTSRNQGANI-UHFFFAOYSA-N.
| Molecular formula | C16H16O2S |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | 2-(2,4-dimethylphenyl)sulfanyl-2-phenylacetic acid |
| InChIKey | UDDBXTSRNQGANI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SC(C2=CC=CC=C2)C(=O)O)C |
Computed by PubChem (NCBI)