Products 63547-34-2

CAS 63547-34-2 is the registry number for Propanoic acid, 3-[(diphenylmethyl)thio]-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-benzhydrylsulfanylpropanoic acid (CAS 63547-34-2) is a chemical compound with the molecular formula C16H16O2S and a molecular weight of 272.4 g/mol. IUPAC name: 3-benzhydrylsulfanylpropanoic acid. InChIKey: UPGWRBLQPLHELY-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16O2S
Molecular weight272.4 g/mol
IUPAC name3-benzhydrylsulfanylpropanoic acid
InChIKeyUPGWRBLQPLHELY-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C2=CC=CC=C2)SCCC(=O)O

Computed by PubChem (NCBI)