Products 1820665-22-2
CAS 1820665-22-2 is the registry number for Ethyl 6-(dimethylsulfamoyl)pyridine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 6-(dimethylsulfamoyl)pyridine-3-carboxylate (CAS 1820665-22-2) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: ethyl 6-(dimethylsulfamoyl)pyridine-3-carboxylate. InChIKey: NKUMVHZHEGMRKP-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | ethyl 6-(dimethylsulfamoyl)pyridine-3-carboxylate |
| InChIKey | NKUMVHZHEGMRKP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C=C1)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)