Products 1820673-23-1
CAS 1820673-23-1 appears in our catalog under these names: Cephalexin hydrate, 97+% , Cephalexin hydrate, first-generation ce. Offered by: Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: 5g, 25g, 10G.
(7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 1820673-23-1) is a chemical compound with the molecular formula C16H17N3O4S and a molecular weight of 347.4 g/mol. IUPAC name: (7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: ZAIPMKNFIOOWCQ-MHSSMOFYSA-N.
| Molecular formula | C16H17N3O4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | (7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | ZAIPMKNFIOOWCQ-MHSSMOFYSA-N |
| SMILES | CC1=C(N2C([C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)N)SC1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
cefalexin HCl monohydrate