Products 1820674-75-6
CAS 1820674-75-6 is the registry number for 7-bromo-4-methoxy-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
7-bromo-4-methoxy-1,3-benzoxazol-2-amine (CAS 1820674-75-6) is a chemical compound with the molecular formula C8H7BrN2O2 and a molecular weight of 243.06 g/mol. IUPAC name: 7-bromo-4-methoxy-1,3-benzoxazol-2-amine. InChIKey: FWJZZGUANNDQLF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O2 |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | 7-bromo-4-methoxy-1,3-benzoxazol-2-amine |
| InChIKey | FWJZZGUANNDQLF-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)Br)OC(=N2)N |
Computed by PubChem (NCBI)