CAS 2169906-54-9 appears in our catalog under these names: 7-Bromo-8-methyl-1h-pyrido[2,3-b][1,4]oxazin-2-one, 95%, 7-bromo-8-methyl-1H-pyrido(2,3-b)(1,4)oxazin-2(3H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
7-bromo-8-methyl-1H-pyrido[2,3-b][1,4]oxazin-2-one (CAS 2169906-54-9) is a chemical compound with the molecular formula C8H7BrN2O2 and a molecular weight of 243.06 g/mol. IUPAC name: 7-bromo-8-methyl-1H-pyrido[2,3-b][1,4]oxazin-2-one. InChIKey: BCKOEEPFDDVUPO-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O2 |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | 7-bromo-8-methyl-1H-pyrido[2,3-b][1,4]oxazin-2-one |
| InChIKey | BCKOEEPFDDVUPO-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC=C1Br)OCC(=O)N2 |
Computed by PubChem (NCBI)