Products 87240-06-0
CAS 87240-06-0 appears in our catalog under these names: 7-Bromo-5-nitroindoline, 95%, 7-Bromo-5-nitroindoline, 7-Bromo-5-nitroindoline 97%, 7-Bromo-5-nitroindoline, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g, 25g.
7-bromo-5-nitro-2,3-dihydro-1H-indole (CAS 87240-06-0) is a chemical compound with the molecular formula C8H7BrN2O2 and a molecular weight of 243.06 g/mol. IUPAC name: 7-bromo-5-nitro-2,3-dihydro-1H-indole. InChIKey: WCSNLUZLJCPUDG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O2 |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | 7-bromo-5-nitro-2,3-dihydro-1H-indole |
| InChIKey | WCSNLUZLJCPUDG-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=C(C=C2Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)