CAS 1936248-77-9 is the registry number for 4-Bromo-6-methyl-2h-pyrido[3,2-b][1,4]oxazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-bromo-6-methylpyrido[3,2-b][1,4]oxazin-3-one (CAS 1936248-77-9) is a chemical compound with the molecular formula C8H7BrN2O2 and a molecular weight of 243.06 g/mol. IUPAC name: 4-bromo-6-methylpyrido[3,2-b][1,4]oxazin-3-one. InChIKey: MNZKBCUDCGFHFJ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O2 |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | 4-bromo-6-methylpyrido[3,2-b][1,4]oxazin-3-one |
| InChIKey | MNZKBCUDCGFHFJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)OCC(=O)N2Br |
Computed by PubChem (NCBI)