Products 1388064-25-2
CAS 1388064-25-2 appears in our catalog under these names: 2H-Benzimidazol-2-one, 4-bromo-1,3-dihydro-6-methoxy-, 95%, 4-Bromo-6-methoxy-1,3-dihydro-benzoimidazol-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg.
4-bromo-6-methoxy-1,3-dihydrobenzimidazol-2-one (CAS 1388064-25-2) is a chemical compound with the molecular formula C8H7BrN2O2 and a molecular weight of 243.06 g/mol. IUPAC name: 4-bromo-6-methoxy-1,3-dihydrobenzimidazol-2-one. InChIKey: OWGRFTNXMDCMGS-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O2 |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | 4-bromo-6-methoxy-1,3-dihydrobenzimidazol-2-one |
| InChIKey | OWGRFTNXMDCMGS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)Br)NC(=O)N2 |
Computed by PubChem (NCBI)