CAS 1820675-13-5 is the registry number for methyl 3-fluoro-5-(5-fluoro-2-methylphenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-fluoro-5-(5-fluoro-2-methylphenyl)benzoate (CAS 1820675-13-5) is a chemical compound with the molecular formula C15H12F2O2 and a molecular weight of 262.25 g/mol. IUPAC name: methyl 3-fluoro-5-(5-fluoro-2-methylphenyl)benzoate. InChIKey: BOCPANXGHWRSKY-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O2 |
|---|---|
| Molecular weight | 262.25 g/mol |
| IUPAC name | methyl 3-fluoro-5-(5-fluoro-2-methylphenyl)benzoate |
| InChIKey | BOCPANXGHWRSKY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)F)C2=CC(=CC(=C2)F)C(=O)OC |
Computed by PubChem (NCBI)