CAS 2140327-06-4 is the registry number for Methyl 4-(3,5-difluorophenyl)-3-methylbenzoate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 4-(3,5-difluorophenyl)-3-methylbenzoate (CAS 2140327-06-4) is a chemical compound with the molecular formula C15H12F2O2 and a molecular weight of 262.25 g/mol. IUPAC name: methyl 4-(3,5-difluorophenyl)-3-methylbenzoate. InChIKey: ISXATGKXDBNMNW-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O2 |
|---|---|
| Molecular weight | 262.25 g/mol |
| IUPAC name | methyl 4-(3,5-difluorophenyl)-3-methylbenzoate |
| InChIKey | ISXATGKXDBNMNW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)