CAS 221179-71-1 appears in our catalog under these names: 2–(3,4–Difluorophenyl)–1–(4–methoxyphenyl)ethan–1–one, 2-(3,4-Difluorophenyl)-1-(4-methoxyphenyl)ethanone, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
2-(3,4-difluorophenyl)-1-(4-methoxyphenyl)ethanone (CAS 221179-71-1) is a chemical compound with the molecular formula C15H12F2O2 and a molecular weight of 262.25 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-1-(4-methoxyphenyl)ethanone. InChIKey: UYHZUQFBVHICAW-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O2 |
|---|---|
| Molecular weight | 262.25 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-1-(4-methoxyphenyl)ethanone |
| InChIKey | UYHZUQFBVHICAW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)CC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)