CAS 2270912-60-0 is the registry number for 3-[2-(2,4-Difluoro-phenyl)-ethyl]-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[2-(2,4-difluorophenyl)ethyl]benzoic acid (CAS 2270912-60-0) is a chemical compound with the molecular formula C15H12F2O2 and a molecular weight of 262.25 g/mol. IUPAC name: 3-[2-(2,4-difluorophenyl)ethyl]benzoic acid. InChIKey: GIEYWIXRBCFGIL-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O2 |
|---|---|
| Molecular weight | 262.25 g/mol |
| IUPAC name | 3-[2-(2,4-difluorophenyl)ethyl]benzoic acid |
| InChIKey | GIEYWIXRBCFGIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CCC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)