Products 1820685-18-4
CAS 1820685-18-4 is the registry number for tert-Butyl 4,7-dichloroindole-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Tert-butyl 4,7-dichloroindole-1-carboxylate (CAS 1820685-18-4) is a chemical compound with the molecular formula C13H13Cl2NO2 and a molecular weight of 286.15 g/mol. IUPAC name: tert-butyl 4,7-dichloroindole-1-carboxylate. InChIKey: LNSBSXKOMJBSJA-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2NO2 |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | tert-butyl 4,7-dichloroindole-1-carboxylate |
| InChIKey | LNSBSXKOMJBSJA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C(C=CC(=C21)Cl)Cl |
Computed by PubChem (NCBI)