CAS 278597-30-1 is the registry number for (3-(2,6-Dichlorophenyl)-5-isopropylisoxazol-4-yl)methanol, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methanol (CAS 278597-30-1) is a chemical compound with the molecular formula C13H13Cl2NO2 and a molecular weight of 286.15 g/mol. IUPAC name: [3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methanol. InChIKey: QKFSDLYZZTWMQG-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2NO2 |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | [3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methanol |
| InChIKey | QKFSDLYZZTWMQG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)CO |
Computed by PubChem (NCBI)