Products 900641-03-4
CAS 900641-03-4 is the registry number for METHYL 2-(CHLOROMETHYL)-4-METHYLQUINOLINE-3-CARBOXYLATE HYDROCHLORIDE, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Methyl 2-(chloromethyl)-4-methylquinoline-3-carboxylate;hydrochloride (CAS 900641-03-4) is a chemical compound with the molecular formula C13H13Cl2NO2 and a molecular weight of 286.15 g/mol. IUPAC name: methyl 2-(chloromethyl)-4-methylquinoline-3-carboxylate;hydrochloride. InChIKey: JVBFMQIDEMTWIA-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2NO2 |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | methyl 2-(chloromethyl)-4-methylquinoline-3-carboxylate;hydrochloride |
| InChIKey | JVBFMQIDEMTWIA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=CC=CC=C12)CCl)C(=O)OC.Cl |
Computed by PubChem (NCBI)