Products 1881331-13-0
CAS 1881331-13-0 is the registry number for tert-butyl 2,4-dichloro-1H-indole-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 2,4-dichloroindole-1-carboxylate (CAS 1881331-13-0) is a chemical compound with the molecular formula C13H13Cl2NO2 and a molecular weight of 286.15 g/mol. IUPAC name: tert-butyl 2,4-dichloroindole-1-carboxylate. InChIKey: APCUUZDNOXPRSG-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2NO2 |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | tert-butyl 2,4-dichloroindole-1-carboxylate |
| InChIKey | APCUUZDNOXPRSG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=C1Cl)C(=CC=C2)Cl |
Computed by PubChem (NCBI)