Products 1820703-56-7
CAS 1820703-56-7 is the registry number for methyl 2-(5-bromo-4-chloro-2-nitrophenyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-(5-bromo-4-chloro-2-nitrophenyl)acetate (CAS 1820703-56-7) is a chemical compound with the molecular formula C9H7BrClNO4 and a molecular weight of 308.51 g/mol. IUPAC name: methyl 2-(5-bromo-4-chloro-2-nitrophenyl)acetate. InChIKey: FTPDRNFEFYDLGB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClNO4 |
|---|---|
| Molecular weight | 308.51 g/mol |
| IUPAC name | methyl 2-(5-bromo-4-chloro-2-nitrophenyl)acetate |
| InChIKey | FTPDRNFEFYDLGB-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C=C1[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)