Products 103029-90-9

CAS 103029-90-9 is the registry number for 5-Bromo-2-((carboxymethyl)amino)-4-chlorobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-bromo-2-(carboxymethylamino)-4-chlorobenzoic acid (CAS 103029-90-9) is a chemical compound with the molecular formula C9H7BrClNO4 and a molecular weight of 308.51 g/mol. IUPAC name: 5-bromo-2-(carboxymethylamino)-4-chlorobenzoic acid. InChIKey: DQBPHLIXARHNHO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrClNO4
Molecular weight308.51 g/mol
IUPAC name5-bromo-2-(carboxymethylamino)-4-chlorobenzoic acid
InChIKeyDQBPHLIXARHNHO-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1Br)Cl)NCC(=O)O)C(=O)O

Computed by PubChem (NCBI)