Products 1845689-93-1
CAS 1845689-93-1 is the registry number for Ethyl 4-bromo-5-chloro-2-nitrobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
Ethyl 4-bromo-5-chloro-2-nitrobenzoate (CAS 1845689-93-1) is a chemical compound with the molecular formula C9H7BrClNO4 and a molecular weight of 308.51 g/mol. IUPAC name: ethyl 4-bromo-5-chloro-2-nitrobenzoate. InChIKey: QWBIBDXHJYUTBB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClNO4 |
|---|---|
| Molecular weight | 308.51 g/mol |
| IUPAC name | ethyl 4-bromo-5-chloro-2-nitrobenzoate |
| InChIKey | QWBIBDXHJYUTBB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1[N+](=O)[O-])Br)Cl |
Computed by PubChem (NCBI)