Products 1503959-72-5
CAS 1503959-72-5 is the registry number for Ethyl 3-bromo-4-chloro-5-nitrobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Ethyl 3-bromo-4-chloro-5-nitrobenzoate (CAS 1503959-72-5) is a chemical compound with the molecular formula C9H7BrClNO4 and a molecular weight of 308.51 g/mol. IUPAC name: ethyl 3-bromo-4-chloro-5-nitrobenzoate. InChIKey: WABNGGIFKDTJIW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClNO4 |
|---|---|
| Molecular weight | 308.51 g/mol |
| IUPAC name | ethyl 3-bromo-4-chloro-5-nitrobenzoate |
| InChIKey | WABNGGIFKDTJIW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)Br)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)