CAS 1441173-02-9 is the registry number for Methyl 2-(bromomethyl)-5-chloro-4-nitrobenzoate, 95+%. Offered by: AmBeed. Available pack sizes: 250mg.
Methyl 2-(bromomethyl)-5-chloro-4-nitrobenzoate (CAS 1441173-02-9) is a chemical compound with the molecular formula C9H7BrClNO4 and a molecular weight of 308.51 g/mol. IUPAC name: methyl 2-(bromomethyl)-5-chloro-4-nitrobenzoate. InChIKey: YZZYBIJGZZQMPH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClNO4 |
|---|---|
| Molecular weight | 308.51 g/mol |
| IUPAC name | methyl 2-(bromomethyl)-5-chloro-4-nitrobenzoate |
| InChIKey | YZZYBIJGZZQMPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1CBr)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)