Products 1820734-90-4
CAS 1820734-90-4 is the registry number for 2-((3-Fluorophenyl)carbonyl)piperidine hydrochloride. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
(3-fluorophenyl)-piperidin-2-ylmethanone;hydrochloride (CAS 1820734-90-4) is a chemical compound with the molecular formula C12H15ClFNO and a molecular weight of 243.70 g/mol. IUPAC name: (3-fluorophenyl)-piperidin-2-ylmethanone;hydrochloride. InChIKey: NZGDGXNOFHKMPB-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO |
|---|---|
| Molecular weight | 243.70 g/mol |
| IUPAC name | (3-fluorophenyl)-piperidin-2-ylmethanone;hydrochloride |
| InChIKey | NZGDGXNOFHKMPB-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C(=O)C2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)