Products 1820806-09-4
CAS 1820806-09-4 appears in our catalog under these names: 7–Methoxy obtusifolin, 7-Methoxy obtusifolin, 7-Methoxy obtusifolin, ≥98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 1 mg, 5 mg, 10mg, 20mg.
2,8-dihydroxy-1,7-dimethoxy-3-methylanthracene-9,10-dione (CAS 1820806-09-4) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: 2,8-dihydroxy-1,7-dimethoxy-3-methylanthracene-9,10-dione. InChIKey: SLDOOOYICLSPEH-UHFFFAOYSA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | 2,8-dihydroxy-1,7-dimethoxy-3-methylanthracene-9,10-dione |
| InChIKey | SLDOOOYICLSPEH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1O)OC)C(=O)C3=C(C2=O)C=CC(=C3O)OC |
Computed by PubChem (NCBI)
Synonyms:
7-Methoxy obtusifolin, orb1981827